ChemNet > CAS > 3325-11-9 5-Aminobenzotriazole
3325-11-9 5-Aminobenzotriazole
| product Name |
5-Aminobenzotriazole |
| CAS No |
3325-11-9 |
| Synonyms |
1H-Benzotriazol-6-amine; 1H-Benzotriazol-5-amine; 2H-benzotriazol-5-amine |
| Molecular Formula |
C6H6N4 |
| Molecular Weight |
134.1386 |
| InChI |
InChI=1/C6H6N4/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,7H2,(H,8,9,10) |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Boiling point |
387.4°C at 760 mmHg |
| Refractive index |
1.806 |
| Flash point |
216.5°C |
| Vapour Pressur |
3.29E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
