ChemNet > CAS > 3343-59-7 3,4-Dihydroxybenzaldoxime
3343-59-7 3,4-Dihydroxybenzaldoxime
| product Name |
3,4-Dihydroxybenzaldoxime |
| CAS No |
3343-59-7 |
| Synonyms |
Benzaldehyde, 3,4-dihydroxy-, oxime; (4E)-2-hydroxy-4-[(hydroxyamino)methylidene]cyclohexa-2,5-dien-1-one |
| Molecular Formula |
C7H7NO3 |
| Molecular Weight |
153.1354 |
| InChI |
InChI=1/C7H7NO3/c9-6-2-1-5(4-8-11)3-7(6)10/h1-4,8,10-11H/b5-4+ |
| Molecular Structure |
|
| Density |
1.672g/cm3 |
| Boiling point |
317.2°C at 760 mmHg |
| Refractive index |
1.823 |
| Flash point |
145.6°C |
| Vapour Pressur |
3.29E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
