ChemNet > CAS > 33524-31-1 2,5-Dimethoxybenzyl alcohol
33524-31-1 2,5-Dimethoxybenzyl alcohol
| product Name |
2,5-Dimethoxybenzyl alcohol |
| CAS No |
33524-31-1 |
| Synonyms |
(2,5-dimethoxyphenyl)methanol |
| Molecular Formula |
C9H12O3 |
| Molecular Weight |
168.1898 |
| InChI |
InChI=1/C9H12O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-5,10H,6H2,1-2H3 |
| EINECS |
251-562-0 |
| Molecular Structure |
|
| Density |
1.111g/cm3 |
| Boiling point |
305.6°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
127.7°C |
| Vapour Pressur |
0.000354mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
