ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| product Name |
Methyl methylsulfinylmethyl sulfide |
| CAS No |
33577-16-1 |
| Synonyms |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| Molecular Formula |
C3H8OS2 |
| Molecular Weight |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| EINECS |
251-577-2 |
| Molecular Structure |
|
| Density |
1.223g/cm3 |
| Melting point |
222-226℃ |
| Boiling point |
257.772°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
121.4°C |
| Vapour Pressur |
0.023mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
