ChemNet > CAS > 33588-54-4 5-Bromoindoxyl diacetate
33588-54-4 5-Bromoindoxyl diacetate
| product Name |
5-Bromoindoxyl diacetate |
| CAS No |
33588-54-4 |
| Synonyms |
1-Acetyl-5-bromoindol-3-ol acetate; N-acetyl-5-bromoindolyl acetate; 3-Acetoxy-1-acetyl-5-bromoindole; 1-acetyl-5-bromo-1H-indol-3-yl acetate |
| Molecular Formula |
C12H10BrNO3 |
| Molecular Weight |
296.1167 |
| InChI |
InChI=1/C12H10BrNO3/c1-7(15)14-6-12(17-8(2)16)10-5-9(13)3-4-11(10)14/h3-6H,1-2H3 |
| EINECS |
251-584-0 |
| Molecular Structure |
|
| Density |
1.54g/cm3 |
| Melting point |
125-128℃ |
| Boiling point |
395.7°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
193.1°C |
| Vapour Pressur |
1.81E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
