ChemNet > CAS > 33632-27-8 1-Acetyl-5-nitroindoline
33632-27-8 1-Acetyl-5-nitroindoline
| product Name |
1-Acetyl-5-nitroindoline |
| CAS No |
33632-27-8 |
| Molecular Formula |
C10H10N2O3 |
| Molecular Weight |
206.198 |
| InChI |
InChI=1/C10H10N2O3/c1-7(13)11-5-4-8-6-9(12(14)15)2-3-10(8)11/h2-3,6H,4-5H2,1H3 |
| EINECS |
251-609-5 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
170-171℃ |
| Boiling point |
466.4°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
235.9°C |
| Vapour Pressur |
7.1E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
