ChemNet > CAS > 3365-85-3 4,4''-Diamino-p-terphenyl
3365-85-3 4,4''-Diamino-p-terphenyl
| product Name |
4,4''-Diamino-p-terphenyl |
| CAS No |
3365-85-3 |
| Synonyms |
4,4''-Diaminoterphenyl; CCRIS 4965; (1,1':4',1''-Terphenyl)-4,4''-diamine; p,p'-Diaminoterphenyl |
| Molecular Formula |
C18H16N2 |
| Molecular Weight |
260.333 |
| InChI |
InChI=1/C18H16N2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H,19-20H2 |
| Molecular Structure |
|
| Density |
1.159g/cm3 |
| Boiling point |
484.2°C at 760 mmHg |
| Refractive index |
1.67 |
| Flash point |
296.3°C |
| Vapour Pressur |
1.57E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
