ChemNet > CAS > 3366-47-0 (-)-Tetra-O-acetyl-2-hydroxy-D-glucal
3366-47-0 (-)-Tetra-O-acetyl-2-hydroxy-D-glucal
| product Name |
(-)-Tetra-O-acetyl-2-hydroxy-D-glucal |
| CAS No |
3366-47-0 |
| Synonyms |
2,3,4,5-Tetra-O-acetyl-1-deoxy-D-arabino-hex-1-enopyranose; 2,3,4,6-tetra-O-acetyl-1,5-anhydro-D-arabino-hex-1-enitol |
| Molecular Formula |
C14H18O9 |
| Molecular Weight |
330.2873 |
| InChI |
InChI=1/C14H18O9/c1-7(15)19-5-11-13(22-9(3)17)14(23-10(4)18)12(6-20-11)21-8(2)16/h6,11,13-14H,5H2,1-4H3/t11-,13-,14-/m1/s1 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
60℃ |
| Boiling point |
375.8°C at 760 mmHg |
| Refractive index |
1.489 |
| Flash point |
162.7°C |
| Vapour Pressur |
7.59E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
0086-10-87149610 88459036 |
| Email |
sales@ouhechem.com |
| Address |
19# Minhanglu, Haidian, Beijing, China |