33733-73-2 3-Bromothioanisole
product Name |
3-Bromothioanisole |
CAS No |
33733-73-2 |
Synonyms |
3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
Molecular Formula |
C7H7BrOS |
Molecular Weight |
219.0989 |
InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
Molecular Structure |
|
Density |
1.567g/cm3 |
Boiling point |
278.106°C at 760 mmHg |
Refractive index |
1.616 |
Flash point |
121.995°C |
Vapour Pressur |
0.007mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S23:;
S24/25:;
|
|