ChemNet > CAS > 3377-86-4 2-bromohexane
3377-86-4 2-bromohexane
| product Name |
2-bromohexane |
| CAS No |
3377-86-4 |
| Synonyms |
Hexane, 2-bromo- |
| Molecular Formula |
C6H13Br |
| Molecular Weight |
165.0714 |
| InChI |
InChI=1/C6H13Br/c1-3-4-5-6(2)7/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| EINECS |
222-173-3 |
| Molecular Structure |
|
| Density |
1.169g/cm3 |
| Boiling point |
144°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
40.1°C |
| Vapour Pressur |
6.54mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
