33775-94-9 2-Iodothioanisole
| product Name |
2-Iodothioanisole |
| CAS No |
33775-94-9 |
| Synonyms |
2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
| Molecular Formula |
C7H7IS |
| Molecular Weight |
250.0999 |
| InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.78g/cm3 |
| Boiling point |
253°C at 760 mmHg |
| Refractive index |
1.67 |
| Flash point |
106.8°C |
| Vapour Pressur |
0.0298mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|