ChemNet > CAS > 3386-42-3 2,5-dichlorophenyl isothiocyanate
3386-42-3 2,5-dichlorophenyl isothiocyanate
| product Name |
2,5-dichlorophenyl isothiocyanate |
| CAS No |
3386-42-3 |
| Synonyms |
2,5-Dichloroisothiocyanatobenzene; 1,4-dichloro-2-isothiocyanatobenzene |
| Molecular Formula |
C7H3Cl2NS |
| Molecular Weight |
204.0764 |
| InChI |
InChI=1/C7H3Cl2NS/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Boiling point |
305.9°C at 760 mmHg |
| Refractive index |
1.614 |
| Flash point |
138.8°C |
| Vapour Pressur |
0.00144mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
