ChemNet > CAS > 3389-57-9 4-tetrahydro-1H-pyrrol-1-ylpent-3-en-2-one
3389-57-9 4-tetrahydro-1H-pyrrol-1-ylpent-3-en-2-one
| product Name |
4-tetrahydro-1H-pyrrol-1-ylpent-3-en-2-one |
| CAS No |
3389-57-9 |
| Synonyms |
4-(pyrrolidin-1-yl)pent-3-en-2-one; (3E)-4-pyrrolidin-1-ylpent-3-en-2-one; (3Z)-4-pyrrolidin-1-ylpent-3-en-2-one |
| Molecular Formula |
C9H15NO |
| Molecular Weight |
153.2215 |
| InChI |
InChI=1/C9H15NO/c1-8(7-9(2)11)10-5-3-4-6-10/h7H,3-6H2,1-2H3/b8-7- |
| Molecular Structure |
|
| Density |
0.995g/cm3 |
| Melting point |
114℃ |
| Boiling point |
248.4°C at 760 mmHg |
| Refractive index |
1.496 |
| Flash point |
88.2°C |
| Vapour Pressur |
0.0243mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
