ChemNet > CAS > 33898-90-7 2-Thenoylacetonitrile
33898-90-7 2-Thenoylacetonitrile
| product Name |
2-Thenoylacetonitrile |
| CAS No |
33898-90-7 |
| Synonyms |
3-Oxo-3-(2-thienyl)propionitrile; 3-Oxo-3-(2-thienyl)propanenitrile; 3-oxo-3-(thiophen-2-yl)propanenitrile |
| Molecular Formula |
C7H5NOS |
| Molecular Weight |
151.1857 |
| InChI |
InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
| Molecular Structure |
|
| Density |
1.256g/cm3 |
| Melting point |
128-134℃ |
| Boiling point |
338.3°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
158.4°C |
| Vapour Pressur |
9.88E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
