ChemNet > CAS > 3396-11-0 Cesium acetate
3396-11-0 Cesium acetate
| product Name |
Cesium acetate |
| CAS No |
3396-11-0 |
| Synonyms |
Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
| Molecular Formula |
C2H3CsO2 |
| Molecular Weight |
191.9495 |
| InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| EINECS |
222-248-0 |
| Molecular Structure |
|
| Melting point |
194-195℃ |
| Boiling point |
117.1°C at 760 mmHg |
| Flash point |
40°C |
| Vapour Pressur |
13.9mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
