ChemNet > CAS > 33974-27-5 phenyl(4-pyridyl)methanol
33974-27-5 phenyl(4-pyridyl)methanol
| product Name |
phenyl(4-pyridyl)methanol |
| CAS No |
33974-27-5 |
| Synonyms |
alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
| Molecular Formula |
C12H11NO |
| Molecular Weight |
185.2218 |
| InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
| EINECS |
251-770-1 |
| Molecular Structure |
|
| Density |
1.155g/cm3 |
| Melting point |
120℃ |
| Boiling point |
353.5°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
167.6°C |
| Vapour Pressur |
1.32E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
