ChemNet > CAS > 342002-80-6 3-Borono-Benzoic acid 1-(1-methylethyl) ester
342002-80-6 3-Borono-Benzoic acid 1-(1-methylethyl) ester
| product Name |
3-Borono-Benzoic acid 1-(1-methylethyl) ester |
| CAS No |
342002-80-6 |
| Synonyms |
3-Isopropoxycarbonylphenylboronic acid; {3-[(1-methylethoxy)carbonyl]phenyl}boronic acid; 4-(2H-tetrazol-5-yl)benzaldehyde |
| Molecular Formula |
C8H6N4O |
| Molecular Weight |
174.1594 |
| InChI |
InChI=1/C8H6N4O/c13-5-6-1-3-7(4-2-6)8-9-11-12-10-8/h1-5H,(H,9,10,11,12) |
| Molecular Structure |
|
| Density |
1.4g/cm3 |
| Boiling point |
409°C at 760 mmHg |
| Refractive index |
1.667 |
| Flash point |
203.2°C |
| Vapour Pressur |
6.71E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
