ChemNet > CAS > 34231-78-2 Acetoxybenzaldehyde; 97%
34231-78-2 Acetoxybenzaldehyde; 97%
| product Name |
Acetoxybenzaldehyde; 97% |
| CAS No |
34231-78-2 |
| Synonyms |
3-Acetoxybenzaldehyde; 3-Formylphenyl acetate |
| Molecular Formula |
C9H8O3 |
| Molecular Weight |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
| EINECS |
251-890-4 |
| Molecular Structure |
|
| Density |
1.183g/cm3 |
| Boiling point |
271.6°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
117.6°C |
| Vapour Pressur |
0.00637mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
