ChemNet > CAS > 342394-00-7 ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate
342394-00-7 ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate
| product Name |
ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate |
| CAS No |
342394-00-7 |
| Molecular Formula |
C13H14N2O2S |
| Molecular Weight |
262.3275 |
| InChI |
InChI=1/C13H14N2O2S/c1-2-17-12(16)11-9-15-13(18-11)14-8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,14,15) |
| Molecular Structure |
|
| Density |
1.269g/cm3 |
| Boiling point |
410.6°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
202.1°C |
| Vapour Pressur |
5.97E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
