ChemNet > CAS > 3425-89-6 Methylcyclohexene dicarboxylic anhydride
3425-89-6 Methylcyclohexene dicarboxylic anhydride
| product Name |
Methylcyclohexene dicarboxylic anhydride |
| CAS No |
3425-89-6 |
| Synonyms |
4-Methyl-4-cyclohexene-1,2-dicarboxylic anhydride; 5-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione; 1,2,3,6-Tetrahydro-4-methylphthalic anhydride; 4-MTHPA |
| Molecular Formula |
C9H10O3 |
| Molecular Weight |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-5-2-3-6-7(4-5)9(11)12-8(6)10/h2-3,5-7H,4H2,1H3 |
| EINECS |
222-323-8 |
| Molecular Structure |
|
| Density |
1.204g/cm3 |
| Boiling point |
303°C at 760 mmHg |
| Refractive index |
1.507 |
| Flash point |
142.9°C |
| Vapour Pressur |
0.000957mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R41:Risks of serious damage to eyes.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Safety Description |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
