ChemNet > CAS > 3430-23-7 3,5-Dibromo-4-methylpyridine
3430-23-7 3,5-Dibromo-4-methylpyridine
| product Name |
3,5-Dibromo-4-methylpyridine |
| CAS No |
3430-23-7 |
| Synonyms |
3,5-Dibromo-4-picoline |
| Molecular Formula |
C6H5Br2N |
| Molecular Weight |
250.9186 |
| InChI |
InChI=1/C6H5Br2N/c1-4-5(7)2-9-3-6(4)8/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.911g/cm3 |
| Boiling point |
243°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
100.7°C |
| Vapour Pressur |
0.0513mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
