344-14-9 dimethyl fluoromalonate
| product Name |
dimethyl fluoromalonate |
| CAS No |
344-14-9 |
| Synonyms |
Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester; Dimethyl 2-Fluoromalonate |
| Molecular Formula |
C5H7FO4 |
| Molecular Weight |
150.1051 |
| InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| Molecular Structure |
|
| Density |
1.211g/cm3 |
| Boiling point |
140.3°C at 760 mmHg |
| Refractive index |
1.382 |
| Flash point |
38.4°C |
| Vapour Pressur |
6.18mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Telephone |
+86-515-68892900 |
| Email |
jiangxiaowei@rivocean.com |
| Address |
Ninghai Road, Binhai Chemical Park, Yancheng, Jiangsu, China |