ChemNet > CAS > 3440-24-2 3',4',7,8-Tetrahydroxyflavone
3440-24-2 3',4',7,8-Tetrahydroxyflavone
| product Name |
3',4',7,8-Tetrahydroxyflavone |
| CAS No |
3440-24-2 |
| Synonyms |
2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-4H-chromen-4-one |
| Molecular Formula |
C15H10O6 |
| Molecular Weight |
286.2363 |
| InChI |
InChI=1/C15H10O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-6,16-17,19-20H |
| Molecular Structure |
|
| Density |
1.654g/cm3 |
| Boiling point |
618.9°C at 760 mmHg |
| Refractive index |
1.767 |
| Flash point |
240.6°C |
| Vapour Pressur |
6.57E-16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
