ChemNet > CAS > 3440-99-1 5-(3-Bromophenyl)-1H-tetrazole
3440-99-1 5-(3-Bromophenyl)-1H-tetrazole
| product Name |
5-(3-Bromophenyl)-1H-tetrazole |
| CAS No |
3440-99-1 |
| Synonyms |
5-(3-bromophenyl)-2H-tetrazole |
| Molecular Formula |
C7H5BrN4 |
| Molecular Weight |
225.0454 |
| InChI |
InChI=1/C7H5BrN4/c8-6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
| Molecular Structure |
|
| Density |
1.745g/cm3 |
| Boiling point |
390.7°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
190.1°C |
| Vapour Pressur |
2.61E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
