ChemNet > CAS > 3445-84-9 N,N-Bis(2-cyanoethyl)formamide
3445-84-9 N,N-Bis(2-cyanoethyl)formamide
| product Name |
N,N-Bis(2-cyanoethyl)formamide |
| CAS No |
3445-84-9 |
| Synonyms |
3,3-(Formylimino)dipropionitrile; NN-Bis(2-cyanoethyl)formamide, Pract. |
| Molecular Formula |
C7H9N3O |
| Molecular Weight |
151.1659 |
| InChI |
InChI=1/C7H9N3O/c8-3-1-5-10(7-11)6-2-4-9/h7H,1-2,5-6H2 |
| EINECS |
222-362-0 |
| Molecular Structure |
|
| Density |
1.116g/cm3 |
| Boiling point |
444.1°C at 760 mmHg |
| Refractive index |
1.476 |
| Flash point |
222.4°C |
| Vapour Pressur |
4.39E-08mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
