ChemNet > CAS > 34490-86-3 Dimethyl suberimidate dihydrochloride
34490-86-3 Dimethyl suberimidate dihydrochloride
| product Name |
Dimethyl suberimidate dihydrochloride |
| CAS No |
34490-86-3 |
| Synonyms |
Suberimidic acid dimethyl ester dihydrochloride; dimethyl (1Z,8Z)-octanebis(imidoate); dimethyl (1Z,8Z)-octanebis(imidoate) dihydrochloride; dimethyl octanebis(imidoate) |
| Molecular Formula |
C10H20N2O2 |
| Molecular Weight |
200.278 |
| InChI |
InChI=1/C10H20N2O2/c1-13-9(11)7-5-3-4-6-8-10(12)14-2/h11-12H,3-8H2,1-2H3 |
| EINECS |
252-060-4 |
| Molecular Structure |
|
| Density |
1.01g/cm3 |
| Melting point |
213-216℃ |
| Boiling point |
247.437°C at 760 mmHg |
| Refractive index |
1.465 |
| Flash point |
103.447°C |
| Vapour Pressur |
0.04mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
