ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
| product Name |
3,3'-difluorobenzophenone |
| CAS No |
345-70-0 |
| Synonyms |
bis(3-fluorophenyl)methanone |
| Molecular Formula |
C13H8F2O |
| Molecular Weight |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
| Molecular Structure |
|
| Density |
1.239g/cm3 |
| Melting point |
56-59℃ |
| Boiling point |
316.2°C at 760 mmHg |
| Refractive index |
1.549 |
| Flash point |
121.3°C |
| Vapour Pressur |
0.000415mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
