ChemNet > CAS > 3468-17-5 6-(Aminomethyl)indole
3468-17-5 6-(Aminomethyl)indole
| product Name |
6-(Aminomethyl)indole |
| CAS No |
3468-17-5 |
| Synonyms |
INDOLE-6-METHYLAMINE; 1H-INDOLE-6-METHANAMINE; ; 1-(1H-indol-6-yl)methanamine |
| Molecular Formula |
C9H10N2 |
| Molecular Weight |
146.1891 |
| InChI |
InChI=1/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Boiling point |
335.599°C at 760 mmHg |
| Refractive index |
1.698 |
| Flash point |
183.277°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
