ChemNet > CAS > 347-55-7 2-(trifluoromethylthio)aniline
347-55-7 2-(trifluoromethylthio)aniline
| product Name |
2-(trifluoromethylthio)aniline |
| CAS No |
347-55-7 |
| Synonyms |
2-Aminophenyl trifluoromethyl sulphide; 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| Molecular Formula |
C11H11FO4 |
| Molecular Weight |
226.201 |
| InChI |
InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| EINECS |
206-473-1 |
| Molecular Structure |
|
| Density |
1.279g/cm3 |
| Boiling point |
422.6°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
209.4°C |
| Vapour Pressur |
6.78E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
