ChemNet > CAS > 3481-20-7 2,3,5,6-Tetrachloroaniline
3481-20-7 2,3,5,6-Tetrachloroaniline
| product Name |
2,3,5,6-Tetrachloroaniline |
| CAS No |
3481-20-7 |
| Synonyms |
NSC 29028; Aniline, 2,3,5,6-tetrachloro- (8CI); Benzenamine, 2,3,5,6-tetrachloro- (9CI) |
| Molecular Formula |
C6H3Cl4N |
| Molecular Weight |
230.9067 |
| InChI |
InChI=1/C6H3Cl4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2 |
| EINECS |
222-461-9 |
| Molecular Structure |
|
| Density |
1.655g/cm3 |
| Boiling point |
299.1°C at 760 mmHg |
| Refractive index |
1.636 |
| Flash point |
134.7°C |
| Vapour Pressur |
0.00122mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
