ChemNet > CAS > 34819-86-8 3,4-di-O-acetyl-6-deoxy-L-glucal
34819-86-8 3,4-di-O-acetyl-6-deoxy-L-glucal
| product Name |
3,4-di-O-acetyl-6-deoxy-L-glucal |
| CAS No |
34819-86-8 |
| Synonyms |
3,4-Di-O-acetyl-L-rhamnal; 3,4-di-O-acetyl-2,6-anhydro-1,5-dideoxyhex-5-enitol; 3,4-di-O-acetyl-1,5-anhydro-2,6-dideoxy-L-arabino-hex-1-enitol |
| Molecular Formula |
C10H14O5 |
| Molecular Weight |
214.2152 |
| InChI |
InChI=1/C10H14O5/c1-6-10(15-8(3)12)9(4-5-13-6)14-7(2)11/h4-6,9-10H,1-3H3/t6-,9-,10-/m0/s1 |
| EINECS |
252-228-7 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
295.9°C at 760 mmHg |
| Refractive index |
1.474 |
| Flash point |
116.5°C |
| Vapour Pressur |
0.00149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
