34824-58-3 2-Bromophenyldioxolane
product Name |
2-Bromophenyldioxolane |
CAS No |
34824-58-3 |
Synonyms |
2-(2-Bromophenyl)-1,3-dioxolane; 2-Bromobenzaldehyde ethylene acetal |
Molecular Formula |
C9H9BrO2 |
Molecular Weight |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h1-4,9H,5-6H2 |
Molecular Structure |
|
Density |
1.515g/cm3 |
Boiling point |
272.1°C at 760 mmHg |
Refractive index |
1.564 |
Flash point |
120.8°C |
Vapour Pressur |
0.0103mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|