ChemNet > CAS > 35086-82-9 2-Chlorocinnamoyl chloride
35086-82-9 2-Chlorocinnamoyl chloride
| product Name |
2-Chlorocinnamoyl chloride |
| CAS No |
35086-82-9 |
| Synonyms |
2-Chlorocinnamic acid chloride; (2E)-3-(2-chlorophenyl)prop-2-enoyl chloride |
| Molecular Formula |
C9H6Cl2O |
| Molecular Weight |
201.0493 |
| InChI |
InChI=1/C9H6Cl2O/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6H/b6-5+ |
| Molecular Structure |
|
| Density |
1.332g/cm3 |
| Boiling point |
296°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
118.9°C |
| Vapour Pressur |
0.00147mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
