ChemNet > CAS > 35112-27-7 Ethyl 2,5-dichlorobenzoate
35112-27-7 Ethyl 2,5-dichlorobenzoate
| product Name |
Ethyl 2,5-dichlorobenzoate |
| CAS No |
35112-27-7 |
| Synonyms |
2,5-Dichlorobenzoic acid ethyl ester |
| Molecular Formula |
C9H8Cl2O2 |
| Molecular Weight |
219.0646 |
| InChI |
InChI=1/C9H8Cl2O2/c1-2-13-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3 |
| EINECS |
252-373-6 |
| Molecular Structure |
|
| Density |
1.305g/cm3 |
| Boiling point |
281.4°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
116.8°C |
| Vapour Pressur |
0.00357mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
