ChemNet > CAS > 3512-18-3 2,3,6-Trifluoropyridine
3512-18-3 2,3,6-Trifluoropyridine
| product Name |
2,3,6-Trifluoropyridine |
| CAS No |
3512-18-3 |
| Molecular Formula |
C5H2F3N |
| Molecular Weight |
133.0713 |
| InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| Molecular Structure |
|
| Density |
1.396g/cm3 |
| Boiling point |
123.7°C at 760 mmHg |
| Refractive index |
1.424 |
| Flash point |
28.6°C |
| Vapour Pressur |
15.9mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
