ChemNet > CAS > 352018-92-9 5-iodo-2-phenoxypyridine
352018-92-9 5-iodo-2-phenoxypyridine
| product Name |
5-iodo-2-phenoxypyridine |
| CAS No |
352018-92-9 |
| Molecular Formula |
C11H8INO |
| Molecular Weight |
297.0918 |
| InChI |
InChI=1/C11H8INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H |
| Molecular Structure |
|
| Density |
1.694g/cm3 |
| Boiling point |
339.8°C at 760 mmHg |
| Refractive index |
1.646 |
| Flash point |
159.3°C |
| Vapour Pressur |
0.000177mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
