ChemNet > CAS > 3538-65-6 Butyric acid hydrazide
3538-65-6 Butyric acid hydrazide
| product Name |
Butyric acid hydrazide |
| CAS No |
3538-65-6 |
| Synonyms |
Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
| Molecular Formula |
C4H10N2O |
| Molecular Weight |
102.135 |
| InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
| EINECS |
222-579-0 |
| Molecular Structure |
|
| Density |
0.98g/cm3 |
| Boiling point |
249.8°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
104.9°C |
| Vapour Pressur |
0.0224mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
