ChemNet > CAS > 35450-36-3 Methyl 2-bromo-5-methoxybenzoate
35450-36-3 Methyl 2-bromo-5-methoxybenzoate
| product Name |
Methyl 2-bromo-5-methoxybenzoate |
| CAS No |
35450-36-3 |
| Synonyms |
2-Bromo-5-methoxybenzoic acid methyl ester |
| Molecular Formula |
C9H9BrO3 |
| Molecular Weight |
245.07 |
| InChI |
InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.462g/cm3 |
| Boiling point |
291.9°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
130.4°C |
| Vapour Pressur |
0.00189mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
