ChemNet > CAS > 3550-21-8 Benzhydryl isothiocyanate
3550-21-8 Benzhydryl isothiocyanate
| product Name |
Benzhydryl isothiocyanate |
| CAS No |
3550-21-8 |
| Synonyms |
Diphenylmethyl isothiocyanate; 1,1'-(isothiocyanatomethanediyl)dibenzene |
| Molecular Formula |
C14H11NS |
| Molecular Weight |
225.3088 |
| InChI |
InChI=1/C14H11NS/c16-11-15-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Melting point |
58℃ |
| Boiling point |
333.3°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
163°C |
| Vapour Pressur |
0.000266mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
