ChemNet > CAS > 35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
| product Name |
ethyl 2-(3-methoxyphenyl)acetate |
| CAS No |
35553-92-5 |
| Synonyms |
Ethyl 3-methoxyphenylacetate |
| Molecular Formula |
C11H14O3 |
| Molecular Weight |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-3-14-11(12)8-9-5-4-6-10(7-9)13-2/h4-7H,3,8H2,1-2H3 |
| EINECS |
252-614-5 |
| Molecular Structure |
|
| Density |
1.062g/cm3 |
| Boiling point |
271.6°C at 760 mmHg |
| Refractive index |
1.497 |
| Flash point |
108.5°C |
| Vapour Pressur |
0.00637mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
