ChemNet > CAS > 35817-27-7 4-Ethoxycoumarin
35817-27-7 4-Ethoxycoumarin
| product Name |
4-Ethoxycoumarin |
| CAS No |
35817-27-7 |
| Synonyms |
4-ethoxy-2H-chromen-2-one |
| Molecular Formula |
C11H10O3 |
| Molecular Weight |
190.1953 |
| InChI |
InChI=1/C11H10O3/c1-2-13-10-7-11(12)14-9-6-4-3-5-8(9)10/h3-7H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Boiling point |
356.2°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
148.4°C |
| Vapour Pressur |
2.97E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
