ChemNet > CAS > 3586-14-9 3-Phenoxytoluene
3586-14-9 3-Phenoxytoluene
| product Name |
3-Phenoxytoluene |
| CAS No |
3586-14-9 |
| Synonyms |
Phenyl m-tolyl ether; 3-Methyldiphenyl ether; 1-methyl-3-phenoxybenzene |
| Molecular Formula |
C13H12O |
| Molecular Weight |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10H,1H3 |
| EINECS |
222-716-4 |
| Molecular Structure |
|
| Density |
1.045g/cm3 |
| Boiling point |
269.1°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
110.8°C |
| Vapour Pressur |
0.0122mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
