ChemNet > CAS > 35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
| product Name |
2-Methyl-1-(3-methylphenyl)piperazine |
| CAS No |
35947-10-5 |
| Synonyms |
2-Methyl-1-(m-tolyl)-piperazine; (3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium; (3R)-3-methyl-4-(3-methylphenyl)piperazin-1-ium |
| Molecular Formula |
C12H19N2 |
| Molecular Weight |
191.2921 |
| InChI |
InChI=1/C12H18N2/c1-10-4-3-5-12(8-10)14-7-6-13-9-11(14)2/h3-5,8,11,13H,6-7,9H2,1-2H3/p+1/t11-/m1/s1 |
| EINECS |
252-810-0 |
| Molecular Structure |
|
| Boiling point |
326.9°C at 760 mmHg |
| Flash point |
147.4°C |
| Vapour Pressur |
0.00021mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
