ChemNet > CAS > 36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid
36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid
| product Name |
2,5-Dichlorothiophene-3-carboxylic acid |
| CAS No |
36157-41-2 |
| Synonyms |
2,5-Dichloro-3-Thiopheneformic Acid; 2,5-dichlorothiophene-3-carboxylate |
| Molecular Formula |
C5HCl2O2S |
| Molecular Weight |
196.0318 |
| InChI |
InChI=1/C5H2Cl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)/p-1 |
| Molecular Structure |
|
| Boiling point |
296.6°C at 760 mmHg |
| Flash point |
133.2°C |
| Vapour Pressur |
0.000641mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
