ChemNet > CAS > 36192-63-9 2-Amino-4'-methylbenzophenone
36192-63-9 2-Amino-4'-methylbenzophenone
| product Name |
2-Amino-4'-methylbenzophenone |
| CAS No |
36192-63-9 |
| Synonyms |
2-Amino-4'-methylbenzophenone m; (2-aminophenyl)(4-methylphenyl)methanone |
| Molecular Formula |
C14H13NO |
| Molecular Weight |
211.2591 |
| InChI |
InChI=1/C14H13NO/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15/h2-9H,15H2,1H3 |
| EINECS |
252-905-7 |
| Molecular Structure |
|
| Density |
1.135g/cm3 |
| Melting point |
91-94℃ |
| Boiling point |
407.1°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
200°C |
| Vapour Pressur |
7.75E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
