ChemNet > CAS > 36238-99-0 Diisopropyl phenylphosphonite
36238-99-0 Diisopropyl phenylphosphonite
| product Name |
Diisopropyl phenylphosphonite |
| CAS No |
36238-99-0 |
| Synonyms |
dipropan-2-yl phenylphosphonite |
| Molecular Formula |
C12H19O2P |
| Molecular Weight |
226.2518 |
| InChI |
InChI=1/C12H19O2P/c1-10(2)13-15(14-11(3)4)12-8-6-5-7-9-12/h5-11H,1-4H3 |
| Molecular Structure |
|
| Boiling point |
262.5°C at 760 mmHg |
| Flash point |
134.5°C |
| Vapour Pressur |
0.0177mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
