ChemNet > CAS > 36255-44-4 3-bromopropionaldehyde dimethyl acetal
36255-44-4 3-bromopropionaldehyde dimethyl acetal
| product Name |
3-bromopropionaldehyde dimethyl acetal |
| CAS No |
36255-44-4 |
| Synonyms |
1-Bromo-3,3-dimethoxypropane; 3-bromo-1,1-dimethoxypropane |
| Molecular Formula |
C5H11BrO2 |
| Molecular Weight |
183.0436 |
| InChI |
InChI=1/C5H11BrO2/c1-7-5(8-2)3-4-6/h5H,3-4H2,1-2H3 |
| EINECS |
252-936-6 |
| Molecular Structure |
|
| Density |
1.332g/cm3 |
| Boiling point |
164.8°C at 760 mmHg |
| Refractive index |
1.442 |
| Flash point |
14°C |
| Vapour Pressur |
2.54mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
