ChemNet > CAS > 36556-56-6 6-Chloro-2,4-difluoroaniline
36556-56-6 6-Chloro-2,4-difluoroaniline
| product Name |
6-Chloro-2,4-difluoroaniline |
| CAS No |
36556-56-6 |
| Synonyms |
2-chloro-4,6-difluoroaniline |
| Molecular Formula |
C6H4ClF2N |
| Molecular Weight |
163.5525 |
| InChI |
InChI=1/C6H4ClF2N/c7-6-4(9)1-3(8)2-5(6)10/h1-2H,10H2 |
| Molecular Structure |
|
| Density |
1.459g/cm3 |
| Melting point |
28℃ |
| Boiling point |
208.3°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
92.2°C |
| Vapour Pressur |
0.215mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
