ChemNet > CAS > 37107-50-9 Cyclohexylidenecyanoacetic acid
37107-50-9 Cyclohexylidenecyanoacetic acid
| product Name |
Cyclohexylidenecyanoacetic acid |
| CAS No |
37107-50-9 |
| Synonyms |
Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
| Molecular Formula |
C9H11NO2 |
| Molecular Weight |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
| EINECS |
253-351-9 |
| Molecular Structure |
|
| Density |
1.211g/cm3 |
| Boiling point |
353.9°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
167.8°C |
| Vapour Pressur |
5.84E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
