ChemNet > CAS > 374537-97-0 2-Amino-5-bromo-3,4-dimethylpyridine
374537-97-0 2-Amino-5-bromo-3,4-dimethylpyridine
| product Name |
2-Amino-5-bromo-3,4-dimethylpyridine |
| CAS No |
374537-97-0 |
| Synonyms |
5-Bromo-3,4-dimethyl-2-pyridinamine; 5-bromo-3,4-dimethylpyridin-2-amine |
| Molecular Formula |
C7H9BrN2 |
| Molecular Weight |
201.0638 |
| InChI |
InChI=1/C7H9BrN2/c1-4-5(2)7(9)10-3-6(4)8/h3H,1-2H3,(H2,9,10) |
| Molecular Structure |
|
| Density |
1.504g/cm3 |
| Boiling point |
278.2°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
122°C |
| Vapour Pressur |
0.00434mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
